C11H20O2 — CID 134858500
(5Z)-8-(methoxymethyl)-2,6-dimethyl-3,4,7,8-tetrahydro-2H-oxocine (PubChem CID 134858500) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (5Z)-8-(methoxymethyl)-2,6-dimethyl-3,4,7,8-tetrahydro-2H-oxocine.
| Compound Name | (5Z)-8-(methoxymethyl)-2,6-dimethyl-3,4,7,8-tetrahydro-2H-oxocine |
|---|---|
| PubChem CID | 134858500 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (5Z)-8-(methoxymethyl)-2,6-dimethyl-3,4,7,8-tetrahydro-2H-oxocine |
| SMILES | COCC1C/C(C)=C\CCC(C)O1 |
| InChI | InChI=1S/C11H20O2/c1-9-5-4-6-10(2)13-11(7-9)8-12-3/h5,10-11H,4,6-8H2,1-3H3/b9-5- |
| InChIKey | BXTSBFVSYPIGCS-UITAMQMPSA-N |
| XLogP | 2.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|