C13H18O3 — CID 134858502
(1R,3aS,7aR)-3a-methoxy-5,7-dimethyl-6-oxo-2,3,7,7a-tetrahydro-1H-indene-1-carbaldehyde (PubChem CID 134858502) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (1R,3aS,7aR)-3a-methoxy-5,7-dimethyl-6-oxo-2,3,7,7a-tetrahydro-1H-indene-1-carbaldehyde.
| Compound Name | (1R,3aS,7aR)-3a-methoxy-5,7-dimethyl-6-oxo-2,3,7,7a-tetrahydro-1H-indene-1-carbaldehyde |
|---|---|
| PubChem CID | 134858502 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (1R,3aS,7aR)-3a-methoxy-5,7-dimethyl-6-oxo-2,3,7,7a-tetrahydro-1H-indene-1-carbaldehyde |
| SMILES | CO[C@]12C=C(C)C(=O)C(C)[C@H]1[C@H](C=O)CC2 |
| InChI | InChI=1S/C13H18O3/c1-8-6-13(16-3)5-4-10(7-14)11(13)9(2)12(8)15/h6-7,9-11H,4-5H2,1-3H3/t9?,10-,11-,13+/m0/s1 |
| InChIKey | LBXIVXAWQRRGMX-SFRIWDOYSA-N |
| XLogP | 1.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|