C11H20O4 — CID 134858564
(4R,5S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,5-trimethyl-1,3-dioxolane (PubChem CID 134858564) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is (4R,5S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,5-trimethyl-1,3-dioxolane.
| Compound Name | (4R,5S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,5-trimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 134858564 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (4R,5S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2,5-trimethyl-1,3-dioxolane |
| SMILES | C[C@@H]1OC(C)(C)O[C@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C11H20O4/c1-7-9(15-11(4,5)13-7)8-6-12-10(2,3)14-8/h7-9H,6H2,1-5H3/t7-,8+,9+/m0/s1 |
| InChIKey | NLGVYSPDEQIDOS-DJLDLDEBSA-N |
| XLogP | 1.68 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |