About 4-(2-methylphenyl)hexa-2,3-dien-1-ol
4-(2-methylphenyl)hexa-2,3-dien-1-ol (PubChem CID 134858645) has the molecular formula C13H16O
and a molecular weight of 188.27 g/mol. Its IUPAC name is 4-(2-methylphenyl)hexa-2,3-dien-1-ol.
Molecular Properties
| Compound Name | 4-(2-methylphenyl)hexa-2,3-dien-1-ol |
| PubChem CID | 134858645 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 4-(2-methylphenyl)hexa-2,3-dien-1-ol |
| SMILES | CCC(=C=CCO)c1ccccc1C |
| InChI | InChI=1S/C13H16O/c1-3-12(8-6-10-14)13-9-5-4-7-11(13)2/h4-7,9,14H,3,10H2,1-2H3 |
| InChIKey | MPKNMWMLPJAQPW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(2-methylphenyl)hexa-2,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylphenyl)hexa-2,3-dien-1-ol?
The IUPAC name of 4-(2-methylphenyl)hexa-2,3-dien-1-ol (CID 134858645) is 4-(2-methylphenyl)hexa-2,3-dien-1-ol.
What is the SMILES notation for 4-(2-methylphenyl)hexa-2,3-dien-1-ol?
The canonical SMILES for 4-(2-methylphenyl)hexa-2,3-dien-1-ol is CCC(=C=CCO)c1ccccc1C.
What is the InChIKey of 4-(2-methylphenyl)hexa-2,3-dien-1-ol?
The InChIKey is MPKNMWMLPJAQPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O/c1-3-12(8-6-10-14)13-9-5-4-7-11(13)2/h4-7,9,14H,3,10H2,1-2H3.
What are the key properties of 4-(2-methylphenyl)hexa-2,3-dien-1-ol?
4-(2-methylphenyl)hexa-2,3-dien-1-ol has a molecular weight of 188.27 g/mol, XLogP of 2.94, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylphenyl)hexa-2,3-dien-1-ol is sourced from PubChem (CID 134858645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).