C15H30O5 — CID 134858654
(3R,7S)-1,1,9,9-tetramethoxy-3,7-dimethylnonan-5-one (PubChem CID 134858654) has the molecular formula C15H30O5 and a molecular weight of 290.40 g/mol. Its IUPAC name is (3R,7S)-1,1,9,9-tetramethoxy-3,7-dimethylnonan-5-one.
| Compound Name | (3R,7S)-1,1,9,9-tetramethoxy-3,7-dimethylnonan-5-one |
|---|---|
| PubChem CID | 134858654 |
| Molecular Formula | C15H30O5 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | (3R,7S)-1,1,9,9-tetramethoxy-3,7-dimethylnonan-5-one |
| SMILES | COC(C[C@H](C)CC(=O)C[C@H](C)CC(OC)OC)OC |
| InChI | InChI=1S/C15H30O5/c1-11(9-14(17-3)18-4)7-13(16)8-12(2)10-15(19-5)20-6/h11-12,14-15H,7-10H2,1-6H3/t11-,12+ |
| InChIKey | HCCIKONHHIJNGS-TXEJJXNPSA-N |
| XLogP | 2.63 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|