C9H16O4 — CID 134858773
[(4R,5S,6R)-5,6-dihydroxyhept-1-en-4-yl] acetate (PubChem CID 134858773) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is [(4R,5S,6R)-5,6-dihydroxyhept-1-en-4-yl] acetate.
| Compound Name | [(4R,5S,6R)-5,6-dihydroxyhept-1-en-4-yl] acetate |
|---|---|
| PubChem CID | 134858773 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | [(4R,5S,6R)-5,6-dihydroxyhept-1-en-4-yl] acetate |
| SMILES | C=CC[C@@H](OC(C)=O)[C@@H](O)[C@@H](C)O |
| InChI | InChI=1S/C9H16O4/c1-4-5-8(13-7(3)11)9(12)6(2)10/h4,6,8-10,12H,1,5H2,2-3H3/t6-,8-,9+/m1/s1 |
| InChIKey | IKLXQZZXUQVPLN-VDAHYXPESA-N |
| XLogP | 0.24 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|