C12H12F2O2S — CID 134858804
(1,1-difluoro-4-methylpenta-2,3-dienyl)sulfonylbenzene (PubChem CID 134858804) has the molecular formula C12H12F2O2S and a molecular weight of 258.29 g/mol. Its IUPAC name is (1,1-difluoro-4-methylpenta-2,3-dienyl)sulfonylbenzene.
| Compound Name | (1,1-difluoro-4-methylpenta-2,3-dienyl)sulfonylbenzene |
|---|---|
| PubChem CID | 134858804 |
| Molecular Formula | C12H12F2O2S |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | (1,1-difluoro-4-methylpenta-2,3-dienyl)sulfonylbenzene |
| SMILES | CC(C)=C=CC(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H12F2O2S/c1-10(2)8-9-12(13,14)17(15,16)11-6-4-3-5-7-11/h3-7,9H,1-2H3 |
| InChIKey | YDLSDNWVKYJLDV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |