C15H28O4 — CID 134858857
(2E,11E)-7,7-dimethoxytrideca-2,11-diene-1,13-diol (PubChem CID 134858857) has the molecular formula C15H28O4 and a molecular weight of 272.39 g/mol. Its IUPAC name is (2E,11E)-7,7-dimethoxytrideca-2,11-diene-1,13-diol.
| Compound Name | (2E,11E)-7,7-dimethoxytrideca-2,11-diene-1,13-diol |
|---|---|
| PubChem CID | 134858857 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (2E,11E)-7,7-dimethoxytrideca-2,11-diene-1,13-diol |
| SMILES | COC(CCC/C=C/CO)(CCC/C=C/CO)OC |
| InChI | InChI=1S/C15H28O4/c1-18-15(19-2,11-7-3-5-9-13-16)12-8-4-6-10-14-17/h5-6,9-10,16-17H,3-4,7-8,11-14H2,1-2H3/b9-5+,10-6+ |
| InChIKey | AQTFVKBNQGAUED-NXZHAISVSA-N |
| XLogP | 2.41 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|