C12H12O — CID 134858980
1-ethyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene (PubChem CID 134858980) has the molecular formula C12H12O and a molecular weight of 172.23 g/mol. Its IUPAC name is 1-ethyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene.
| Compound Name | 1-ethyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
|---|---|
| PubChem CID | 134858980 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.09 |
| IUPAC Name | 1-ethyl-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
| SMILES | CCC12C=CC(O1)c1ccccc12 |
| InChI | InChI=1S/C12H12O/c1-2-12-8-7-11(13-12)9-5-3-4-6-10(9)12/h3-8,11H,2H2,1H3 |
| InChIKey | OZPHHIHQZWRDEV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|