About 2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]acetaldehyde
2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]acetaldehyde (PubChem CID 134859003) has the molecular formula C10H16O3
and a molecular weight of 184.23 g/mol. Its IUPAC name is 2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]acetaldehyde |
| PubChem CID | 134859003 |
| Molecular Formula | C10H16O3 |
| Molecular Weight | 184.23 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | 2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]acetaldehyde |
| SMILES | O=CC[C@@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C10H16O3/c11-7-4-9-8-12-10(13-9)5-2-1-3-6-10/h7,9H,1-6,8H2/t9-/m1/s1 |
| InChIKey | AADCSVJAYRPPBE-SECBINFHSA-N |
| XLogP | 1.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]acetaldehyde?
The IUPAC name of 2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]acetaldehyde (CID 134859003) is 2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]acetaldehyde.
What is the SMILES notation for 2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]acetaldehyde?
The canonical SMILES for 2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]acetaldehyde is O=CC[C@@H]1COC2(CCCCC2)O1.
What is the InChIKey of 2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]acetaldehyde?
The InChIKey is AADCSVJAYRPPBE-SECBINFHSA-N. The full InChI is InChI=1S/C10H16O3/c11-7-4-9-8-12-10(13-9)5-2-1-3-6-10/h7,9H,1-6,8H2/t9-/m1/s1.
What are the key properties of 2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]acetaldehyde?
2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]acetaldehyde has a molecular weight of 184.23 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]acetaldehyde is sourced from PubChem (CID 134859003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).