C13H16O3 — CID 134859071
(7aR)-7a-methyl-4-prop-2-enoxy-2,3,6,7-tetrahydroindene-1,5-dione (PubChem CID 134859071) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is (7aR)-7a-methyl-4-prop-2-enoxy-2,3,6,7-tetrahydroindene-1,5-dione.
| Compound Name | (7aR)-7a-methyl-4-prop-2-enoxy-2,3,6,7-tetrahydroindene-1,5-dione |
|---|---|
| PubChem CID | 134859071 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | (7aR)-7a-methyl-4-prop-2-enoxy-2,3,6,7-tetrahydroindene-1,5-dione |
| SMILES | C=CCOC1=C2CCC(=O)[C@]2(C)CCC1=O |
| InChI | InChI=1S/C13H16O3/c1-3-8-16-12-9-4-5-11(15)13(9,2)7-6-10(12)14/h3H,1,4-8H2,2H3/t13-/m1/s1 |
| InChIKey | LHFIJGHCYYPSNT-CYBMUJFWSA-N |
| XLogP | 2.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|