About methyl 2,2-dimethyl-5-prop-2-enoxy-4H-1,3-dioxine-6-carboxylate
methyl 2,2-dimethyl-5-prop-2-enoxy-4H-1,3-dioxine-6-carboxylate (PubChem CID 134859094) has the molecular formula C11H16O5
and a molecular weight of 228.24 g/mol. Its IUPAC name is methyl 2,2-dimethyl-5-prop-2-enoxy-4H-1,3-dioxine-6-carboxylate.
Molecular Properties
| Compound Name | methyl 2,2-dimethyl-5-prop-2-enoxy-4H-1,3-dioxine-6-carboxylate |
| PubChem CID | 134859094 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | methyl 2,2-dimethyl-5-prop-2-enoxy-4H-1,3-dioxine-6-carboxylate |
| SMILES | C=CCOC1=C(C(=O)OC)OC(C)(C)OC1 |
| InChI | InChI=1S/C11H16O5/c1-5-6-14-8-7-15-11(2,3)16-9(8)10(12)13-4/h5H,1,6-7H2,2-4H3 |
| InChIKey | GYVRLYQANCWSEA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 2,2-dimethyl-5-prop-2-enoxy-4H-1,3-dioxine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,2-dimethyl-5-prop-2-enoxy-4H-1,3-dioxine-6-carboxylate?
The IUPAC name of methyl 2,2-dimethyl-5-prop-2-enoxy-4H-1,3-dioxine-6-carboxylate (CID 134859094) is methyl 2,2-dimethyl-5-prop-2-enoxy-4H-1,3-dioxine-6-carboxylate.
What is the SMILES notation for methyl 2,2-dimethyl-5-prop-2-enoxy-4H-1,3-dioxine-6-carboxylate?
The canonical SMILES for methyl 2,2-dimethyl-5-prop-2-enoxy-4H-1,3-dioxine-6-carboxylate is C=CCOC1=C(C(=O)OC)OC(C)(C)OC1.
What is the InChIKey of methyl 2,2-dimethyl-5-prop-2-enoxy-4H-1,3-dioxine-6-carboxylate?
The InChIKey is GYVRLYQANCWSEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O5/c1-5-6-14-8-7-15-11(2,3)16-9(8)10(12)13-4/h5H,1,6-7H2,2-4H3.
What are the key properties of methyl 2,2-dimethyl-5-prop-2-enoxy-4H-1,3-dioxine-6-carboxylate?
methyl 2,2-dimethyl-5-prop-2-enoxy-4H-1,3-dioxine-6-carboxylate has a molecular weight of 228.24 g/mol, XLogP of 1.36, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,2-dimethyl-5-prop-2-enoxy-4H-1,3-dioxine-6-carboxylate is sourced from PubChem (CID 134859094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).