About 4-[2-[(1R,2R)-2-ethylcyclohexyl]oxyethyl]morpholine
4-[2-[(1R,2R)-2-ethylcyclohexyl]oxyethyl]morpholine (PubChem CID 134859276) has the molecular formula C14H27NO2
and a molecular weight of 241.37 g/mol. Its IUPAC name is 4-[2-[(1R,2R)-2-ethylcyclohexyl]oxyethyl]morpholine.
Molecular Properties
| Compound Name | 4-[2-[(1R,2R)-2-ethylcyclohexyl]oxyethyl]morpholine |
| PubChem CID | 134859276 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 4-[2-[(1R,2R)-2-ethylcyclohexyl]oxyethyl]morpholine |
| SMILES | CC[C@@H]1CCCC[C@H]1OCCN1CCOCC1 |
| InChI | InChI=1S/C14H27NO2/c1-2-13-5-3-4-6-14(13)17-12-9-15-7-10-16-11-8-15/h13-14H,2-12H2,1H3/t13-,14-/m1/s1 |
| InChIKey | QIDBXHFGDYTRBO-ZIAGYGMSSA-N |
| XLogP | 2.30 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[2-[(1R,2R)-2-ethylcyclohexyl]oxyethyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(1R,2R)-2-ethylcyclohexyl]oxyethyl]morpholine?
The IUPAC name of 4-[2-[(1R,2R)-2-ethylcyclohexyl]oxyethyl]morpholine (CID 134859276) is 4-[2-[(1R,2R)-2-ethylcyclohexyl]oxyethyl]morpholine.
What is the SMILES notation for 4-[2-[(1R,2R)-2-ethylcyclohexyl]oxyethyl]morpholine?
The canonical SMILES for 4-[2-[(1R,2R)-2-ethylcyclohexyl]oxyethyl]morpholine is CC[C@@H]1CCCC[C@H]1OCCN1CCOCC1.
What is the InChIKey of 4-[2-[(1R,2R)-2-ethylcyclohexyl]oxyethyl]morpholine?
The InChIKey is QIDBXHFGDYTRBO-ZIAGYGMSSA-N. The full InChI is InChI=1S/C14H27NO2/c1-2-13-5-3-4-6-14(13)17-12-9-15-7-10-16-11-8-15/h13-14H,2-12H2,1H3/t13-,14-/m1/s1.
What are the key properties of 4-[2-[(1R,2R)-2-ethylcyclohexyl]oxyethyl]morpholine?
4-[2-[(1R,2R)-2-ethylcyclohexyl]oxyethyl]morpholine has a molecular weight of 241.37 g/mol, XLogP of 2.30, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(1R,2R)-2-ethylcyclohexyl]oxyethyl]morpholine is sourced from PubChem (CID 134859276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).