C12H21BrMg — CID 134859382
magnesium;(1R,2S,3S)-2-ethenyl-1-methanidyl-1-methyl-3-propan-2-ylcyclopentane;bromide (PubChem CID 134859382) has the molecular formula C12H21BrMg and a molecular weight of 269.51 g/mol. Its IUPAC name is magnesium;(1R,2S,3S)-2-ethenyl-1-methanidyl-1-methyl-3-propan-2-ylcyclopentane;bromide.
| Compound Name | magnesium;(1R,2S,3S)-2-ethenyl-1-methanidyl-1-methyl-3-propan-2-ylcyclopentane;bromide |
|---|---|
| PubChem CID | 134859382 |
| Molecular Formula | C12H21BrMg |
| Molecular Weight | 269.51 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | magnesium;(1R,2S,3S)-2-ethenyl-1-methanidyl-1-methyl-3-propan-2-ylcyclopentane;bromide |
| SMILES | C=C[C@H]1[C@H](C(C)C)CC[C@@]1([CH2-])C.[Br-].[Mg+2] |
| InChI | InChI=1S/C12H21.BrH.Mg/c1-6-11-10(9(2)3)7-8-12(11,4)5;;/h6,9-11H,1,4,7-8H2,2-3,5H3;1H;/q-1;;+2/p-1/t10-,11-,12+;;/m0../s1 |
| InChIKey | NARLDODJSWVSBF-KTEWQINWSA-M |
| XLogP | 0.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.51 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|