About spiro[4,7-dihydro-2-benzofuran-3,1'-cyclohexane]-1-one
spiro[4,7-dihydro-2-benzofuran-3,1'-cyclohexane]-1-one (PubChem CID 134859402) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is spiro[4,7-dihydro-2-benzofuran-3,1'-cyclohexane]-1-one.
Molecular Properties
| Compound Name | spiro[4,7-dihydro-2-benzofuran-3,1'-cyclohexane]-1-one |
| PubChem CID | 134859402 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | spiro[4,7-dihydro-2-benzofuran-3,1'-cyclohexane]-1-one |
| SMILES | O=C1OC2(CCCCC2)C2=C1CC=CC2 |
| InChI | InChI=1S/C13H16O2/c14-12-10-6-2-3-7-11(10)13(15-12)8-4-1-5-9-13/h2-3H,1,4-9H2 |
| InChIKey | QUIGFWSCCAKYKK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze spiro[4,7-dihydro-2-benzofuran-3,1'-cyclohexane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4,7-dihydro-2-benzofuran-3,1'-cyclohexane]-1-one?
The IUPAC name of spiro[4,7-dihydro-2-benzofuran-3,1'-cyclohexane]-1-one (CID 134859402) is spiro[4,7-dihydro-2-benzofuran-3,1'-cyclohexane]-1-one.
What is the SMILES notation for spiro[4,7-dihydro-2-benzofuran-3,1'-cyclohexane]-1-one?
The canonical SMILES for spiro[4,7-dihydro-2-benzofuran-3,1'-cyclohexane]-1-one is O=C1OC2(CCCCC2)C2=C1CC=CC2.
What is the InChIKey of spiro[4,7-dihydro-2-benzofuran-3,1'-cyclohexane]-1-one?
The InChIKey is QUIGFWSCCAKYKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c14-12-10-6-2-3-7-11(10)13(15-12)8-4-1-5-9-13/h2-3H,1,4-9H2.
What are the key properties of spiro[4,7-dihydro-2-benzofuran-3,1'-cyclohexane]-1-one?
spiro[4,7-dihydro-2-benzofuran-3,1'-cyclohexane]-1-one has a molecular weight of 204.27 g/mol, XLogP of 2.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4,7-dihydro-2-benzofuran-3,1'-cyclohexane]-1-one is sourced from PubChem (CID 134859402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).