C14H22O4 — CID 134859471
ethyl (2Z,4R,5E,7E)-4-hydroxy-3-methoxy-4-methyldeca-2,5,7-trienoate (PubChem CID 134859471) has the molecular formula C14H22O4 and a molecular weight of 254.33 g/mol. Its IUPAC name is ethyl (2Z,4R,5E,7E)-4-hydroxy-3-methoxy-4-methyldeca-2,5,7-trienoate.
| Compound Name | ethyl (2Z,4R,5E,7E)-4-hydroxy-3-methoxy-4-methyldeca-2,5,7-trienoate |
|---|---|
| PubChem CID | 134859471 |
| Molecular Formula | C14H22O4 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | ethyl (2Z,4R,5E,7E)-4-hydroxy-3-methoxy-4-methyldeca-2,5,7-trienoate |
| SMILES | CC/C=C/C=C/[C@@](C)(O)/C(=C/C(=O)OCC)OC |
| InChI | InChI=1S/C14H22O4/c1-5-7-8-9-10-14(3,16)12(17-4)11-13(15)18-6-2/h7-11,16H,5-6H2,1-4H3/b8-7+,10-9+,12-11-/t14-/m1/s1 |
| InChIKey | VUZKYEABTGHINP-MPNDLCFWSA-N |
| XLogP | 2.35 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|