C20H38 — CID 134859517
2,5,8,8,12-pentamethyl-1,2,3,3a,4,5,6,7,9,10,11,12,13,13a-tetradecahydrocyclopenta[12]annulene (PubChem CID 134859517) has the molecular formula C20H38 and a molecular weight of 278.52 g/mol. Its IUPAC name is 2,5,8,8,12-pentamethyl-1,2,3,3a,4,5,6,7,9,10,11,12,13,13a-tetradecahydrocyclopenta[12]annulene.
| Compound Name | 2,5,8,8,12-pentamethyl-1,2,3,3a,4,5,6,7,9,10,11,12,13,13a-tetradecahydrocyclopenta[12]annulene |
|---|---|
| PubChem CID | 134859517 |
| Molecular Formula | C20H38 |
| Molecular Weight | 278.52 g/mol |
| Exact Mass | 278.30 |
| IUPAC Name | 2,5,8,8,12-pentamethyl-1,2,3,3a,4,5,6,7,9,10,11,12,13,13a-tetradecahydrocyclopenta[12]annulene |
| SMILES | CC1CCCC(C)(C)CCC(C)CC2CC(C)CC2C1 |
| InChI | InChI=1S/C20H38/c1-15-7-6-9-20(4,5)10-8-16(2)12-19-14-17(3)13-18(19)11-15/h15-19H,6-14H2,1-5H3 |
| InChIKey | BEYJNYYDRMQYQT-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.52 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |