C11H20O2 — CID 134859548
(4R,10R)-10-methyl-2-methylideneoxecan-4-ol (PubChem CID 134859548) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (4R,10R)-10-methyl-2-methylideneoxecan-4-ol.
| Compound Name | (4R,10R)-10-methyl-2-methylideneoxecan-4-ol |
|---|---|
| PubChem CID | 134859548 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (4R,10R)-10-methyl-2-methylideneoxecan-4-ol |
| SMILES | C=C1C[C@H](O)CCCCC[C@@H](C)O1 |
| InChI | InChI=1S/C11H20O2/c1-9-6-4-3-5-7-11(12)8-10(2)13-9/h9,11-12H,2-8H2,1H3/t9-,11-/m1/s1 |
| InChIKey | MYXWWBZUPOEHSU-MWLCHTKSSA-N |
| XLogP | 2.62 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |