C15H25LiN2O — CID 134859575
lithium N-[(4-butyl-3,4-dihydropyridin-3-id-5-yl)methyl]-2,2-dimethylpropanamide (PubChem CID 134859575) has the molecular formula C15H25LiN2O and a molecular weight of 256.32 g/mol. Its IUPAC name is lithium N-[(4-butyl-3,4-dihydropyridin-3-id-5-yl)methyl]-2,2-dimethylpropanamide.
| Compound Name | lithium N-[(4-butyl-3,4-dihydropyridin-3-id-5-yl)methyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 134859575 |
| Molecular Formula | C15H25LiN2O |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.21 |
| IUPAC Name | lithium N-[(4-butyl-3,4-dihydropyridin-3-id-5-yl)methyl]-2,2-dimethylpropanamide |
| SMILES | CCCCC1[CH-]C=NC=C1CNC(=O)C(C)(C)C.[Li+] |
| InChI | InChI=1S/C15H25N2O.Li/c1-5-6-7-12-8-9-16-10-13(12)11-17-14(18)15(2,3)4;/h8-10,12H,5-7,11H2,1-4H3,(H,17,18);/q-1;+1 |
| InChIKey | ZVOWCTRBQKGFBJ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|