C12H18O2 — CID 134859585
(4S)-tricyclo[6.2.2.01,6]dodec-2-ene-4,9-diol (PubChem CID 134859585) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (4S)-tricyclo[6.2.2.01,6]dodec-2-ene-4,9-diol.
| Compound Name | (4S)-tricyclo[6.2.2.01,6]dodec-2-ene-4,9-diol |
|---|---|
| PubChem CID | 134859585 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (4S)-tricyclo[6.2.2.01,6]dodec-2-ene-4,9-diol |
| SMILES | OC1CC23C=C[C@@H](O)CC2CC1CC3 |
| InChI | InChI=1S/C12H18O2/c13-10-2-4-12-3-1-8(11(14)7-12)5-9(12)6-10/h2,4,8-11,13-14H,1,3,5-7H2/t8?,9?,10-,11?,12?/m1/s1 |
| InChIKey | YRAYIQWFJVGNFV-JWUQVZSFSA-N |
| XLogP | 1.47 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|