About lithium N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylcarbamimidate
lithium N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylcarbamimidate (PubChem CID 134859587) has the molecular formula C12H17LiN2O2
and a molecular weight of 228.22 g/mol. Its IUPAC name is lithium N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylcarbamimidate.
Molecular Properties
| Compound Name | lithium N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylcarbamimidate |
| PubChem CID | 134859587 |
| Molecular Formula | C12H17LiN2O2 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | lithium N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylcarbamimidate |
| SMILES | COc1ccc(CC/N=C(\[O-])N(C)C)cc1.[Li+] |
| InChI | InChI=1S/C12H18N2O2.Li/c1-14(2)12(15)13-9-8-10-4-6-11(16-3)7-5-10;/h4-7H,8-9H2,1-3H3,(H,13,15);/q;+1/p-1 |
| InChIKey | MGWSGKQMWUELLB-UHFFFAOYSA-M |
| XLogP | -2.48 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | -2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze lithium N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylcarbamimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylcarbamimidate?
The IUPAC name of lithium N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylcarbamimidate (CID 134859587) is lithium N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylcarbamimidate.
What is the SMILES notation for lithium N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylcarbamimidate?
The canonical SMILES for lithium N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylcarbamimidate is COc1ccc(CC/N=C(\[O-])N(C)C)cc1.[Li+].
What is the InChIKey of lithium N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylcarbamimidate?
The InChIKey is MGWSGKQMWUELLB-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H18N2O2.Li/c1-14(2)12(15)13-9-8-10-4-6-11(16-3)7-5-10;/h4-7H,8-9H2,1-3H3,(H,13,15);/q;+1/p-1.
What are the key properties of lithium N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylcarbamimidate?
lithium N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylcarbamimidate has a molecular weight of 228.22 g/mol, XLogP of -2.48, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for lithium N'-[2-(4-methoxyphenyl)ethyl]-N,N-dimethylcarbamimidate is sourced from PubChem (CID 134859587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).