About (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-1,6-dien-3-one
(4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-1,6-dien-3-one (PubChem CID 134859610) has the molecular formula C14H26O2Si
and a molecular weight of 254.45 g/mol. Its IUPAC name is (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-1,6-dien-3-one.
Molecular Properties
| Compound Name | (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-1,6-dien-3-one |
| PubChem CID | 134859610 |
| Molecular Formula | C14H26O2Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-1,6-dien-3-one |
| SMILES | C=CC(=O)[C@@H](C)[C@@H](C=C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H26O2Si/c1-9-12(15)11(3)13(10-2)16-17(7,8)14(4,5)6/h9-11,13H,1-2H2,3-8H3/t11-,13-/m1/s1 |
| InChIKey | GMXZFRWFLNYNIS-DGCLKSJQSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-1,6-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-1,6-dien-3-one?
The IUPAC name of (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-1,6-dien-3-one (CID 134859610) is (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-1,6-dien-3-one.
What is the SMILES notation for (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-1,6-dien-3-one?
The canonical SMILES for (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-1,6-dien-3-one is C=CC(=O)[C@@H](C)[C@@H](C=C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-1,6-dien-3-one?
The InChIKey is GMXZFRWFLNYNIS-DGCLKSJQSA-N. The full InChI is InChI=1S/C14H26O2Si/c1-9-12(15)11(3)13(10-2)16-17(7,8)14(4,5)6/h9-11,13H,1-2H2,3-8H3/t11-,13-/m1/s1.
What are the key properties of (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-1,6-dien-3-one?
(4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-1,6-dien-3-one has a molecular weight of 254.45 g/mol, XLogP of 3.95, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-methylhepta-1,6-dien-3-one is sourced from PubChem (CID 134859610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).