C12H10O6 — CID 134859626
3-methyl-4-[2-(4-methyl-2,5-dioxofuran-3-yl)ethyl]furan-2,5-dione (PubChem CID 134859626) has the molecular formula C12H10O6 and a molecular weight of 250.21 g/mol. Its IUPAC name is 3-methyl-4-[2-(4-methyl-2,5-dioxofuran-3-yl)ethyl]furan-2,5-dione.
| Compound Name | 3-methyl-4-[2-(4-methyl-2,5-dioxofuran-3-yl)ethyl]furan-2,5-dione |
|---|---|
| PubChem CID | 134859626 |
| Molecular Formula | C12H10O6 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 3-methyl-4-[2-(4-methyl-2,5-dioxofuran-3-yl)ethyl]furan-2,5-dione |
| SMILES | CC1=C(CCC2=C(C)C(=O)OC2=O)C(=O)OC1=O |
| InChI | InChI=1S/C12H10O6/c1-5-7(11(15)17-9(5)13)3-4-8-6(2)10(14)18-12(8)16/h3-4H2,1-2H3 |
| InChIKey | LSUJPNXZRULYLE-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|