C15H24O6 — CID 134859627
2-[(3aR,5S,6R,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethyl 2,2-dimethylpropanoate (PubChem CID 134859627) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-[(3aR,5S,6R,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[(3aR,5S,6R,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134859627 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-[(3aR,5S,6R,6aR)-5-formyl-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]ethyl 2,2-dimethylpropanoate |
| SMILES | CC1(C)O[C@H]2O[C@H](C=O)[C@@H](CCOC(=O)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C15H24O6/c1-14(2,3)13(17)18-7-6-9-10(8-16)19-12-11(9)20-15(4,5)21-12/h8-12H,6-7H2,1-5H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | OWDRRBKPQXKLCB-DDHJBXDOSA-N |
| XLogP | 1.66 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|