About [(2R)-4-(4-methyl-2,5-dioxofuran-3-yl)butan-2-yl] acetate
[(2R)-4-(4-methyl-2,5-dioxofuran-3-yl)butan-2-yl] acetate (PubChem CID 134859656) has the molecular formula C11H14O5
and a molecular weight of 226.23 g/mol. Its IUPAC name is [(2R)-4-(4-methyl-2,5-dioxofuran-3-yl)butan-2-yl] acetate.
Molecular Properties
| Compound Name | [(2R)-4-(4-methyl-2,5-dioxofuran-3-yl)butan-2-yl] acetate |
| PubChem CID | 134859656 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | [(2R)-4-(4-methyl-2,5-dioxofuran-3-yl)butan-2-yl] acetate |
| SMILES | CC(=O)O[C@H](C)CCC1=C(C)C(=O)OC1=O |
| InChI | InChI=1S/C11H14O5/c1-6(15-8(3)12)4-5-9-7(2)10(13)16-11(9)14/h6H,4-5H2,1-3H3/t6-/m1/s1 |
| InChIKey | DEWXYQOYUBPRKC-ZCFIWIBFSA-N |
| XLogP | 1.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-4-(4-methyl-2,5-dioxofuran-3-yl)butan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4-(4-methyl-2,5-dioxofuran-3-yl)butan-2-yl] acetate?
The IUPAC name of [(2R)-4-(4-methyl-2,5-dioxofuran-3-yl)butan-2-yl] acetate (CID 134859656) is [(2R)-4-(4-methyl-2,5-dioxofuran-3-yl)butan-2-yl] acetate.
What is the SMILES notation for [(2R)-4-(4-methyl-2,5-dioxofuran-3-yl)butan-2-yl] acetate?
The canonical SMILES for [(2R)-4-(4-methyl-2,5-dioxofuran-3-yl)butan-2-yl] acetate is CC(=O)O[C@H](C)CCC1=C(C)C(=O)OC1=O.
What is the InChIKey of [(2R)-4-(4-methyl-2,5-dioxofuran-3-yl)butan-2-yl] acetate?
The InChIKey is DEWXYQOYUBPRKC-ZCFIWIBFSA-N. The full InChI is InChI=1S/C11H14O5/c1-6(15-8(3)12)4-5-9-7(2)10(13)16-11(9)14/h6H,4-5H2,1-3H3/t6-/m1/s1.
What are the key properties of [(2R)-4-(4-methyl-2,5-dioxofuran-3-yl)butan-2-yl] acetate?
[(2R)-4-(4-methyl-2,5-dioxofuran-3-yl)butan-2-yl] acetate has a molecular weight of 226.23 g/mol, XLogP of 1.12, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4-(4-methyl-2,5-dioxofuran-3-yl)butan-2-yl] acetate is sourced from PubChem (CID 134859656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).