C11H20O2Si — CID 134859795
tert-butyl-dimethyl-[(1S)-1-[(2S)-oxiran-2-yl]prop-2-ynoxy]silane (PubChem CID 134859795) has the molecular formula C11H20O2Si and a molecular weight of 212.36 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1S)-1-[(2S)-oxiran-2-yl]prop-2-ynoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1S)-1-[(2S)-oxiran-2-yl]prop-2-ynoxy]silane |
|---|---|
| PubChem CID | 134859795 |
| Molecular Formula | C11H20O2Si |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | tert-butyl-dimethyl-[(1S)-1-[(2S)-oxiran-2-yl]prop-2-ynoxy]silane |
| SMILES | C#C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CO1 |
| InChI | InChI=1S/C11H20O2Si/c1-7-9(10-8-12-10)13-14(5,6)11(2,3)4/h1,9-10H,8H2,2-6H3/t9-,10-/m0/s1 |
| InChIKey | DTZWQQGEJJPJKG-UWVGGRQHSA-N |
| XLogP | 2.41 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|