About 6,7-dimethyl-5H-thieno[3,2-c]pyridin-4-one
6,7-dimethyl-5H-thieno[3,2-c]pyridin-4-one (PubChem CID 134859835) has the molecular formula C9H9NOS
and a molecular weight of 179.24 g/mol. Its IUPAC name is 6,7-dimethyl-5H-thieno[3,2-c]pyridin-4-one.
Molecular Properties
| Compound Name | 6,7-dimethyl-5H-thieno[3,2-c]pyridin-4-one |
| PubChem CID | 134859835 |
| Molecular Formula | C9H9NOS |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 6,7-dimethyl-5H-thieno[3,2-c]pyridin-4-one |
| SMILES | Cc1[nH]c(=O)c2ccsc2c1C |
| InChI | InChI=1S/C9H9NOS/c1-5-6(2)10-9(11)7-3-4-12-8(5)7/h3-4H,1-2H3,(H,10,11) |
| InChIKey | DVXNSUVBBJZYHP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dimethyl-5H-thieno[3,2-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-5H-thieno[3,2-c]pyridin-4-one?
The IUPAC name of 6,7-dimethyl-5H-thieno[3,2-c]pyridin-4-one (CID 134859835) is 6,7-dimethyl-5H-thieno[3,2-c]pyridin-4-one.
What is the SMILES notation for 6,7-dimethyl-5H-thieno[3,2-c]pyridin-4-one?
The canonical SMILES for 6,7-dimethyl-5H-thieno[3,2-c]pyridin-4-one is Cc1[nH]c(=O)c2ccsc2c1C.
What is the InChIKey of 6,7-dimethyl-5H-thieno[3,2-c]pyridin-4-one?
The InChIKey is DVXNSUVBBJZYHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NOS/c1-5-6(2)10-9(11)7-3-4-12-8(5)7/h3-4H,1-2H3,(H,10,11).
What are the key properties of 6,7-dimethyl-5H-thieno[3,2-c]pyridin-4-one?
6,7-dimethyl-5H-thieno[3,2-c]pyridin-4-one has a molecular weight of 179.24 g/mol, XLogP of 2.21, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-5H-thieno[3,2-c]pyridin-4-one is sourced from PubChem (CID 134859835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).