About (E)-5-ethyl-N,N-bis(prop-2-enyl)oct-4-en-4-amine
(E)-5-ethyl-N,N-bis(prop-2-enyl)oct-4-en-4-amine (PubChem CID 134859908) has the molecular formula C16H29N
and a molecular weight of 235.41 g/mol. Its IUPAC name is (E)-5-ethyl-N,N-bis(prop-2-enyl)oct-4-en-4-amine.
Molecular Properties
| Compound Name | (E)-5-ethyl-N,N-bis(prop-2-enyl)oct-4-en-4-amine |
| PubChem CID | 134859908 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (E)-5-ethyl-N,N-bis(prop-2-enyl)oct-4-en-4-amine |
| SMILES | C=CCN(CC=C)/C(CCC)=C(\CC)CCC |
| InChI | InChI=1S/C16H29N/c1-6-11-15(10-5)16(12-7-2)17(13-8-3)14-9-4/h8-9H,3-4,6-7,10-14H2,1-2,5H3/b16-15+ |
| InChIKey | WDPJBHYQEBYGED-FOCLMDBBSA-N |
| XLogP | 4.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-ethyl-N,N-bis(prop-2-enyl)oct-4-en-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-ethyl-N,N-bis(prop-2-enyl)oct-4-en-4-amine?
The IUPAC name of (E)-5-ethyl-N,N-bis(prop-2-enyl)oct-4-en-4-amine (CID 134859908) is (E)-5-ethyl-N,N-bis(prop-2-enyl)oct-4-en-4-amine.
What is the SMILES notation for (E)-5-ethyl-N,N-bis(prop-2-enyl)oct-4-en-4-amine?
The canonical SMILES for (E)-5-ethyl-N,N-bis(prop-2-enyl)oct-4-en-4-amine is C=CCN(CC=C)/C(CCC)=C(\CC)CCC.
What is the InChIKey of (E)-5-ethyl-N,N-bis(prop-2-enyl)oct-4-en-4-amine?
The InChIKey is WDPJBHYQEBYGED-FOCLMDBBSA-N. The full InChI is InChI=1S/C16H29N/c1-6-11-15(10-5)16(12-7-2)17(13-8-3)14-9-4/h8-9H,3-4,6-7,10-14H2,1-2,5H3/b16-15+.
What are the key properties of (E)-5-ethyl-N,N-bis(prop-2-enyl)oct-4-en-4-amine?
(E)-5-ethyl-N,N-bis(prop-2-enyl)oct-4-en-4-amine has a molecular weight of 235.41 g/mol, XLogP of 4.92, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-ethyl-N,N-bis(prop-2-enyl)oct-4-en-4-amine is sourced from PubChem (CID 134859908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).