About lithium pent-4-enyl 2,2-dimethylpropanoate
lithium pent-4-enyl 2,2-dimethylpropanoate (PubChem CID 134860050) has the molecular formula C10H17LiO2
and a molecular weight of 176.18 g/mol. Its IUPAC name is lithium pent-4-enyl 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | lithium pent-4-enyl 2,2-dimethylpropanoate |
| PubChem CID | 134860050 |
| Molecular Formula | C10H17LiO2 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | lithium pent-4-enyl 2,2-dimethylpropanoate |
| SMILES | [H]/[C-]=C\CCCOC(=O)C(C)(C)C.[Li+] |
| InChI | InChI=1S/C10H17O2.Li/c1-5-6-7-8-12-9(11)10(2,3)4;/h1,5H,6-8H2,2-4H3;/q-1;+1 |
| InChIKey | ZETGWSKNIZIHGO-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium pent-4-enyl 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium pent-4-enyl 2,2-dimethylpropanoate?
The IUPAC name of lithium pent-4-enyl 2,2-dimethylpropanoate (CID 134860050) is lithium pent-4-enyl 2,2-dimethylpropanoate.
What is the SMILES notation for lithium pent-4-enyl 2,2-dimethylpropanoate?
The canonical SMILES for lithium pent-4-enyl 2,2-dimethylpropanoate is [H]/[C-]=C\CCCOC(=O)C(C)(C)C.[Li+].
What is the InChIKey of lithium pent-4-enyl 2,2-dimethylpropanoate?
The InChIKey is ZETGWSKNIZIHGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17O2.Li/c1-5-6-7-8-12-9(11)10(2,3)4;/h1,5H,6-8H2,2-4H3;/q-1;+1.
What are the key properties of lithium pent-4-enyl 2,2-dimethylpropanoate?
lithium pent-4-enyl 2,2-dimethylpropanoate has a molecular weight of 176.18 g/mol, XLogP of -0.65, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium pent-4-enyl 2,2-dimethylpropanoate is sourced from PubChem (CID 134860050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).