C16H11BrN2O3S — CID 1348601
(5Z)-1-(3-bromophenyl)-5-[(3-methylthiophen-2-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 1348601) has the molecular formula C16H11BrN2O3S and a molecular weight of 391.25 g/mol. Its IUPAC name is (5Z)-1-(3-bromophenyl)-5-[(3-methylthiophen-2-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-(3-bromophenyl)-5-[(3-methylthiophen-2-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 1348601 |
| Molecular Formula | C16H11BrN2O3S |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 389.97 |
| IUPAC Name | (5Z)-1-(3-bromophenyl)-5-[(3-methylthiophen-2-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccsc1/C=C1/C(=O)NC(=O)N(c2cccc(Br)c2)C1=O |
| InChI | InChI=1S/C16H11BrN2O3S/c1-9-5-6-23-13(9)8-12-14(20)18-16(22)19(15(12)21)11-4-2-3-10(17)7-11/h2-8H,1H3,(H,18,20,22)/b12-8- |
| InChIKey | ACEDKMXFMBXAMJ-WQLSENKSSA-N |
| XLogP | 3.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|