About 2-benzyl-2,5-diazoniabicyclo[2.2.1]heptane-1-carboxylic acid
2-benzyl-2,5-diazoniabicyclo[2.2.1]heptane-1-carboxylic acid (PubChem CID 134860176) has the molecular formula C13H18N2O2+2
and a molecular weight of 234.30 g/mol. Its IUPAC name is 2-benzyl-2,5-diazoniabicyclo[2.2.1]heptane-1-carboxylic acid.
Molecular Properties
| Compound Name | 2-benzyl-2,5-diazoniabicyclo[2.2.1]heptane-1-carboxylic acid |
| PubChem CID | 134860176 |
| Molecular Formula | C13H18N2O2+2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 2-benzyl-2,5-diazoniabicyclo[2.2.1]heptane-1-carboxylic acid |
| SMILES | O=C(O)C12C[NH2+]C(C[NH+]1Cc1ccccc1)C2 |
| InChI | InChI=1S/C13H16N2O2/c16-12(17)13-6-11(14-9-13)8-15(13)7-10-4-2-1-3-5-10/h1-5,11,14H,6-9H2,(H,16,17)/p+2 |
| InChIKey | JEBMVEZXLXSALB-UHFFFAOYSA-P |
| XLogP | -1.76 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-benzyl-2,5-diazoniabicyclo[2.2.1]heptane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-2,5-diazoniabicyclo[2.2.1]heptane-1-carboxylic acid?
The IUPAC name of 2-benzyl-2,5-diazoniabicyclo[2.2.1]heptane-1-carboxylic acid (CID 134860176) is 2-benzyl-2,5-diazoniabicyclo[2.2.1]heptane-1-carboxylic acid.
What is the SMILES notation for 2-benzyl-2,5-diazoniabicyclo[2.2.1]heptane-1-carboxylic acid?
The canonical SMILES for 2-benzyl-2,5-diazoniabicyclo[2.2.1]heptane-1-carboxylic acid is O=C(O)C12C[NH2+]C(C[NH+]1Cc1ccccc1)C2.
What is the InChIKey of 2-benzyl-2,5-diazoniabicyclo[2.2.1]heptane-1-carboxylic acid?
The InChIKey is JEBMVEZXLXSALB-UHFFFAOYSA-P. The full InChI is InChI=1S/C13H16N2O2/c16-12(17)13-6-11(14-9-13)8-15(13)7-10-4-2-1-3-5-10/h1-5,11,14H,6-9H2,(H,16,17)/p+2.
What are the key properties of 2-benzyl-2,5-diazoniabicyclo[2.2.1]heptane-1-carboxylic acid?
2-benzyl-2,5-diazoniabicyclo[2.2.1]heptane-1-carboxylic acid has a molecular weight of 234.30 g/mol, XLogP of -1.76, 3 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-2,5-diazoniabicyclo[2.2.1]heptane-1-carboxylic acid is sourced from PubChem (CID 134860176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).