C14H20N2O2 — CID 134860257
(2Z,4E)-N-[1-[[(2Z,4E)-hexa-2,4-dienoyl]amino]ethyl]hexa-2,4-dienamide (PubChem CID 134860257) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is (2Z,4E)-N-[1-[[(2Z,4E)-hexa-2,4-dienoyl]amino]ethyl]hexa-2,4-dienamide.
| Compound Name | (2Z,4E)-N-[1-[[(2Z,4E)-hexa-2,4-dienoyl]amino]ethyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 134860257 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | (2Z,4E)-N-[1-[[(2Z,4E)-hexa-2,4-dienoyl]amino]ethyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C\C(=O)NC(C)NC(=O)/C=C\C=C\C |
| InChI | InChI=1S/C14H20N2O2/c1-4-6-8-10-13(17)15-12(3)16-14(18)11-9-7-5-2/h4-12H,1-3H3,(H,15,17)(H,16,18)/b6-4+,7-5+,10-8-,11-9- |
| InChIKey | KUDJCBZAFGOHJT-KWUQKGJSSA-N |
| XLogP | 1.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|