About 3-(2-ethoxypropyl)-1,3,5-trimethylindol-2-one
3-(2-ethoxypropyl)-1,3,5-trimethylindol-2-one (PubChem CID 134860660) has the molecular formula C16H23NO2
and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-(2-ethoxypropyl)-1,3,5-trimethylindol-2-one.
Molecular Properties
| Compound Name | 3-(2-ethoxypropyl)-1,3,5-trimethylindol-2-one |
| PubChem CID | 134860660 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 3-(2-ethoxypropyl)-1,3,5-trimethylindol-2-one |
| SMILES | CCOC(C)CC1(C)C(=O)N(C)c2ccc(C)cc21 |
| InChI | InChI=1S/C16H23NO2/c1-6-19-12(3)10-16(4)13-9-11(2)7-8-14(13)17(5)15(16)18/h7-9,12H,6,10H2,1-5H3 |
| InChIKey | QACLMESKYHEULS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-ethoxypropyl)-1,3,5-trimethylindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-ethoxypropyl)-1,3,5-trimethylindol-2-one?
The IUPAC name of 3-(2-ethoxypropyl)-1,3,5-trimethylindol-2-one (CID 134860660) is 3-(2-ethoxypropyl)-1,3,5-trimethylindol-2-one.
What is the SMILES notation for 3-(2-ethoxypropyl)-1,3,5-trimethylindol-2-one?
The canonical SMILES for 3-(2-ethoxypropyl)-1,3,5-trimethylindol-2-one is CCOC(C)CC1(C)C(=O)N(C)c2ccc(C)cc21.
What is the InChIKey of 3-(2-ethoxypropyl)-1,3,5-trimethylindol-2-one?
The InChIKey is QACLMESKYHEULS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-6-19-12(3)10-16(4)13-9-11(2)7-8-14(13)17(5)15(16)18/h7-9,12H,6,10H2,1-5H3.
What are the key properties of 3-(2-ethoxypropyl)-1,3,5-trimethylindol-2-one?
3-(2-ethoxypropyl)-1,3,5-trimethylindol-2-one has a molecular weight of 261.37 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethoxypropyl)-1,3,5-trimethylindol-2-one is sourced from PubChem (CID 134860660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).