C13H20O4 — CID 134860775
methyl (Z)-4-[(4R,6R)-6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl]but-2-enoate (PubChem CID 134860775) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is methyl (Z)-4-[(4R,6R)-6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl]but-2-enoate.
| Compound Name | methyl (Z)-4-[(4R,6R)-6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl]but-2-enoate |
|---|---|
| PubChem CID | 134860775 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | methyl (Z)-4-[(4R,6R)-6-ethenyl-2,2-dimethyl-1,3-dioxan-4-yl]but-2-enoate |
| SMILES | C=C[C@H]1C[C@@H](C/C=C\C(=O)OC)OC(C)(C)O1 |
| InChI | InChI=1S/C13H20O4/c1-5-10-9-11(17-13(2,3)16-10)7-6-8-12(14)15-4/h5-6,8,10-11H,1,7,9H2,2-4H3/b8-6-/t10-,11+/m0/s1 |
| InChIKey | ORQCJTFPMNUEGF-OBCZMHBZSA-N |
| XLogP | 2.20 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|