C17H26N2 — CID 134860782
(2R,9R)-2-butyl-9-methyl-1,2,3,4,7,8,9,10-octahydro-1,10-phenanthroline (PubChem CID 134860782) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is (2R,9R)-2-butyl-9-methyl-1,2,3,4,7,8,9,10-octahydro-1,10-phenanthroline.
| Compound Name | (2R,9R)-2-butyl-9-methyl-1,2,3,4,7,8,9,10-octahydro-1,10-phenanthroline |
|---|---|
| PubChem CID | 134860782 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | (2R,9R)-2-butyl-9-methyl-1,2,3,4,7,8,9,10-octahydro-1,10-phenanthroline |
| SMILES | CCCC[C@@H]1CCc2ccc3c(c2N1)N[C@H](C)CC3 |
| InChI | InChI=1S/C17H26N2/c1-3-4-5-15-11-10-14-9-8-13-7-6-12(2)18-16(13)17(14)19-15/h8-9,12,15,18-19H,3-7,10-11H2,1-2H3/t12-,15-/m1/s1 |
| InChIKey | VKFRDRSLQVPHTM-IUODEOHRSA-N |
| XLogP | 4.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |