C10H18O3 — CID 134860824
(2R,3R)-2,3,7-trimethyl-1,4,10-trioxaspiro[4.5]decane (PubChem CID 134860824) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (2R,3R)-2,3,7-trimethyl-1,4,10-trioxaspiro[4.5]decane.
| Compound Name | (2R,3R)-2,3,7-trimethyl-1,4,10-trioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 134860824 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (2R,3R)-2,3,7-trimethyl-1,4,10-trioxaspiro[4.5]decane |
| SMILES | CC1CCOC2(C1)O[C@H](C)[C@@H](C)O2 |
| InChI | InChI=1S/C10H18O3/c1-7-4-5-11-10(6-7)12-8(2)9(3)13-10/h7-9H,4-6H2,1-3H3/t7?,8-,9-/m1/s1 |
| InChIKey | SOJRADOGCVLGQM-CFCGPWAMSA-N |
| XLogP | 1.91 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |