About 6,7,8-trimethoxy-1,4-dioxaspiro[4.5]decan-9-one
6,7,8-trimethoxy-1,4-dioxaspiro[4.5]decan-9-one (PubChem CID 134860832) has the molecular formula C11H18O6
and a molecular weight of 246.26 g/mol. Its IUPAC name is 6,7,8-trimethoxy-1,4-dioxaspiro[4.5]decan-9-one.
Molecular Properties
| Compound Name | 6,7,8-trimethoxy-1,4-dioxaspiro[4.5]decan-9-one |
| PubChem CID | 134860832 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 6,7,8-trimethoxy-1,4-dioxaspiro[4.5]decan-9-one |
| SMILES | COC1C(=O)CC2(OCCO2)C(OC)C1OC |
| InChI | InChI=1S/C11H18O6/c1-13-8-7(12)6-11(16-4-5-17-11)10(15-3)9(8)14-2/h8-10H,4-6H2,1-3H3 |
| InChIKey | IONNYOSLVYPPEM-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6,7,8-trimethoxy-1,4-dioxaspiro[4.5]decan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7,8-trimethoxy-1,4-dioxaspiro[4.5]decan-9-one?
The IUPAC name of 6,7,8-trimethoxy-1,4-dioxaspiro[4.5]decan-9-one (CID 134860832) is 6,7,8-trimethoxy-1,4-dioxaspiro[4.5]decan-9-one.
What is the SMILES notation for 6,7,8-trimethoxy-1,4-dioxaspiro[4.5]decan-9-one?
The canonical SMILES for 6,7,8-trimethoxy-1,4-dioxaspiro[4.5]decan-9-one is COC1C(=O)CC2(OCCO2)C(OC)C1OC.
What is the InChIKey of 6,7,8-trimethoxy-1,4-dioxaspiro[4.5]decan-9-one?
The InChIKey is IONNYOSLVYPPEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O6/c1-13-8-7(12)6-11(16-4-5-17-11)10(15-3)9(8)14-2/h8-10H,4-6H2,1-3H3.
What are the key properties of 6,7,8-trimethoxy-1,4-dioxaspiro[4.5]decan-9-one?
6,7,8-trimethoxy-1,4-dioxaspiro[4.5]decan-9-one has a molecular weight of 246.26 g/mol, XLogP of -0.25, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7,8-trimethoxy-1,4-dioxaspiro[4.5]decan-9-one is sourced from PubChem (CID 134860832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).