C11H16O6 — CID 134860868
methyl 2-[(3aS,4S,6S,6aS)-4-formyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate (PubChem CID 134860868) has the molecular formula C11H16O6 and a molecular weight of 244.24 g/mol. Its IUPAC name is methyl 2-[(3aS,4S,6S,6aS)-4-formyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate.
| Compound Name | methyl 2-[(3aS,4S,6S,6aS)-4-formyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate |
|---|---|
| PubChem CID | 134860868 |
| Molecular Formula | C11H16O6 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | methyl 2-[(3aS,4S,6S,6aS)-4-formyl-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]acetate |
| SMILES | COC(=O)C[C@@H]1O[C@H](C=O)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C11H16O6/c1-11(2)16-9-6(4-8(13)14-3)15-7(5-12)10(9)17-11/h5-7,9-10H,4H2,1-3H3/t6-,7+,9-,10+/m0/s1 |
| InChIKey | OYVLRAKEEQZOFR-WPYKOPORSA-N |
| XLogP | 0.04 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|