C12H16O5 — CID 134860891
[(3aR,4S,7aR)-2,2,7-trimethyl-5-oxo-4,7a-dihydro-3aH-1,3-benzodioxol-4-yl] acetate (PubChem CID 134860891) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is [(3aR,4S,7aR)-2,2,7-trimethyl-5-oxo-4,7a-dihydro-3aH-1,3-benzodioxol-4-yl] acetate.
| Compound Name | [(3aR,4S,7aR)-2,2,7-trimethyl-5-oxo-4,7a-dihydro-3aH-1,3-benzodioxol-4-yl] acetate |
|---|---|
| PubChem CID | 134860891 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | [(3aR,4S,7aR)-2,2,7-trimethyl-5-oxo-4,7a-dihydro-3aH-1,3-benzodioxol-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(=O)C=C(C)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C12H16O5/c1-6-5-8(14)10(15-7(2)13)11-9(6)16-12(3,4)17-11/h5,9-11H,1-4H3/t9-,10-,11-/m1/s1 |
| InChIKey | AZHUWYITDFSZLL-GMTAPVOTSA-N |
| XLogP | 0.97 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |