C15H24O3 — CID 134860923
methyl (3S)-3-[(1R)-4,4-dimethyl-2-oxo-1-prop-2-enylcyclopentyl]butanoate (PubChem CID 134860923) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is methyl (3S)-3-[(1R)-4,4-dimethyl-2-oxo-1-prop-2-enylcyclopentyl]butanoate.
| Compound Name | methyl (3S)-3-[(1R)-4,4-dimethyl-2-oxo-1-prop-2-enylcyclopentyl]butanoate |
|---|---|
| PubChem CID | 134860923 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | methyl (3S)-3-[(1R)-4,4-dimethyl-2-oxo-1-prop-2-enylcyclopentyl]butanoate |
| SMILES | C=CC[C@]1([C@@H](C)CC(=O)OC)CC(C)(C)CC1=O |
| InChI | InChI=1S/C15H24O3/c1-6-7-15(11(2)8-13(17)18-5)10-14(3,4)9-12(15)16/h6,11H,1,7-10H2,2-5H3/t11-,15+/m0/s1 |
| InChIKey | FVWFPLHNDJGZJW-XHDPSFHLSA-N |
| XLogP | 3.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|