C11H16O2 — CID 134860947
(1S,5S,8R)-5-hydroxytricyclo[6.3.0.01,5]undecan-4-one (PubChem CID 134860947) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is (1S,5S,8R)-5-hydroxytricyclo[6.3.0.01,5]undecan-4-one.
| Compound Name | (1S,5S,8R)-5-hydroxytricyclo[6.3.0.01,5]undecan-4-one |
|---|---|
| PubChem CID | 134860947 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | (1S,5S,8R)-5-hydroxytricyclo[6.3.0.01,5]undecan-4-one |
| SMILES | O=C1CC[C@@]23CCC[C@@H]2CC[C@@]13O |
| InChI | InChI=1S/C11H16O2/c12-9-4-6-10-5-1-2-8(10)3-7-11(9,10)13/h8,13H,1-7H2/t8-,10+,11-/m1/s1 |
| InChIKey | NZZPMVFWQCOEMK-DVVUODLYSA-N |
| XLogP | 1.66 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |