C13H25NOSi — CID 134860968
2-methyl-1-trimethylsilyl-1,3,4,4a,5,6,8,8a-octahydroisoquinolin-7-one (PubChem CID 134860968) has the molecular formula C13H25NOSi and a molecular weight of 239.43 g/mol. Its IUPAC name is 2-methyl-1-trimethylsilyl-1,3,4,4a,5,6,8,8a-octahydroisoquinolin-7-one.
| Compound Name | 2-methyl-1-trimethylsilyl-1,3,4,4a,5,6,8,8a-octahydroisoquinolin-7-one |
|---|---|
| PubChem CID | 134860968 |
| Molecular Formula | C13H25NOSi |
| Molecular Weight | 239.43 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 2-methyl-1-trimethylsilyl-1,3,4,4a,5,6,8,8a-octahydroisoquinolin-7-one |
| SMILES | CN1CCC2CCC(=O)CC2C1[Si](C)(C)C |
| InChI | InChI=1S/C13H25NOSi/c1-14-8-7-10-5-6-11(15)9-12(10)13(14)16(2,3)4/h10,12-13H,5-9H2,1-4H3 |
| InChIKey | LTZILTYUYBHSRN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|