C12H16O3 — CID 134861000
(3aR,7aR)-7a-hydroxy-3a-prop-2-enyl-3,5,6,7-tetrahydro-2H-indene-1,4-dione (PubChem CID 134861000) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (3aR,7aR)-7a-hydroxy-3a-prop-2-enyl-3,5,6,7-tetrahydro-2H-indene-1,4-dione.
| Compound Name | (3aR,7aR)-7a-hydroxy-3a-prop-2-enyl-3,5,6,7-tetrahydro-2H-indene-1,4-dione |
|---|---|
| PubChem CID | 134861000 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (3aR,7aR)-7a-hydroxy-3a-prop-2-enyl-3,5,6,7-tetrahydro-2H-indene-1,4-dione |
| SMILES | C=CC[C@]12CCC(=O)[C@@]1(O)CCCC2=O |
| InChI | InChI=1S/C12H16O3/c1-2-6-11-8-5-10(14)12(11,15)7-3-4-9(11)13/h2,15H,1,3-8H2/t11-,12+/m1/s1 |
| InChIKey | ZTQYJFPZONAVGC-NEPJUHHUSA-N |
| XLogP | 1.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|