About [(1aR,6aR)-6a-methyl-1,6-dihydrocyclopropa[a]inden-1a-yl]oxy-trimethylsilane
[(1aR,6aR)-6a-methyl-1,6-dihydrocyclopropa[a]inden-1a-yl]oxy-trimethylsilane (PubChem CID 134861022) has the molecular formula C14H20OSi
and a molecular weight of 232.40 g/mol. Its IUPAC name is [(1aR,6aR)-6a-methyl-1,6-dihydrocyclopropa[a]inden-1a-yl]oxy-trimethylsilane.
Molecular Properties
| Compound Name | [(1aR,6aR)-6a-methyl-1,6-dihydrocyclopropa[a]inden-1a-yl]oxy-trimethylsilane |
| PubChem CID | 134861022 |
| Molecular Formula | C14H20OSi |
| Molecular Weight | 232.40 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | [(1aR,6aR)-6a-methyl-1,6-dihydrocyclopropa[a]inden-1a-yl]oxy-trimethylsilane |
| SMILES | C[C@]12Cc3ccccc3[C@@]1(O[Si](C)(C)C)C2 |
| InChI | InChI=1S/C14H20OSi/c1-13-9-11-7-5-6-8-12(11)14(13,10-13)15-16(2,3)4/h5-8H,9-10H2,1-4H3/t13-,14+/m1/s1 |
| InChIKey | HCSQRVABNOCXKB-KGLIPLIRSA-N |
| XLogP | 3.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.40 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(1aR,6aR)-6a-methyl-1,6-dihydrocyclopropa[a]inden-1a-yl]oxy-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1aR,6aR)-6a-methyl-1,6-dihydrocyclopropa[a]inden-1a-yl]oxy-trimethylsilane?
The IUPAC name of [(1aR,6aR)-6a-methyl-1,6-dihydrocyclopropa[a]inden-1a-yl]oxy-trimethylsilane (CID 134861022) is [(1aR,6aR)-6a-methyl-1,6-dihydrocyclopropa[a]inden-1a-yl]oxy-trimethylsilane.
What is the SMILES notation for [(1aR,6aR)-6a-methyl-1,6-dihydrocyclopropa[a]inden-1a-yl]oxy-trimethylsilane?
The canonical SMILES for [(1aR,6aR)-6a-methyl-1,6-dihydrocyclopropa[a]inden-1a-yl]oxy-trimethylsilane is C[C@]12Cc3ccccc3[C@@]1(O[Si](C)(C)C)C2.
What is the InChIKey of [(1aR,6aR)-6a-methyl-1,6-dihydrocyclopropa[a]inden-1a-yl]oxy-trimethylsilane?
The InChIKey is HCSQRVABNOCXKB-KGLIPLIRSA-N. The full InChI is InChI=1S/C14H20OSi/c1-13-9-11-7-5-6-8-12(11)14(13,10-13)15-16(2,3)4/h5-8H,9-10H2,1-4H3/t13-,14+/m1/s1.
What are the key properties of [(1aR,6aR)-6a-methyl-1,6-dihydrocyclopropa[a]inden-1a-yl]oxy-trimethylsilane?
[(1aR,6aR)-6a-methyl-1,6-dihydrocyclopropa[a]inden-1a-yl]oxy-trimethylsilane has a molecular weight of 232.40 g/mol, XLogP of 3.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1aR,6aR)-6a-methyl-1,6-dihydrocyclopropa[a]inden-1a-yl]oxy-trimethylsilane is sourced from PubChem (CID 134861022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).