C16H24O4 — CID 134861043
dimethyl (1R,2S)-3,4-dimethyl-1,2,3,5,6,7,8,8a-octahydronaphthalene-1,2-dicarboxylate (PubChem CID 134861043) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is dimethyl (1R,2S)-3,4-dimethyl-1,2,3,5,6,7,8,8a-octahydronaphthalene-1,2-dicarboxylate.
| Compound Name | dimethyl (1R,2S)-3,4-dimethyl-1,2,3,5,6,7,8,8a-octahydronaphthalene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134861043 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | dimethyl (1R,2S)-3,4-dimethyl-1,2,3,5,6,7,8,8a-octahydronaphthalene-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C2CCCCC2=C(C)C(C)[C@@H]1C(=O)OC |
| InChI | InChI=1S/C16H24O4/c1-9-10(2)13(15(17)19-3)14(16(18)20-4)12-8-6-5-7-11(9)12/h10,12-14H,5-8H2,1-4H3/t10?,12?,13-,14+/m0/s1 |
| InChIKey | RVAUTQSDFGYNQV-AKUTZHFWSA-N |
| XLogP | 2.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|