C11H17ClO2 — CID 134861051
1-[(3aS,4R,5S,7aR)-5-chloro-3a-hydroxy-1,2,3,4,5,6,7,7a-octahydroinden-4-yl]ethanone (PubChem CID 134861051) has the molecular formula C11H17ClO2 and a molecular weight of 216.71 g/mol. Its IUPAC name is 1-[(3aS,4R,5S,7aR)-5-chloro-3a-hydroxy-1,2,3,4,5,6,7,7a-octahydroinden-4-yl]ethanone.
| Compound Name | 1-[(3aS,4R,5S,7aR)-5-chloro-3a-hydroxy-1,2,3,4,5,6,7,7a-octahydroinden-4-yl]ethanone |
|---|---|
| PubChem CID | 134861051 |
| Molecular Formula | C11H17ClO2 |
| Molecular Weight | 216.71 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-[(3aS,4R,5S,7aR)-5-chloro-3a-hydroxy-1,2,3,4,5,6,7,7a-octahydroinden-4-yl]ethanone |
| SMILES | CC(=O)[C@@H]1[C@@H](Cl)CC[C@H]2CCC[C@]21O |
| InChI | InChI=1S/C11H17ClO2/c1-7(13)10-9(12)5-4-8-3-2-6-11(8,10)14/h8-10,14H,2-6H2,1H3/t8-,9+,10-,11+/m1/s1 |
| InChIKey | ORVRAFMKNGMSKM-YTWAJWBKSA-N |
| XLogP | 2.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.71 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|