C14H21NO — CID 134861082
4-[(1S,8aS)-7-oxo-2,3,3a,4,5,6,8,8a-octahydro-1H-azulen-1-yl]butanenitrile (PubChem CID 134861082) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 4-[(1S,8aS)-7-oxo-2,3,3a,4,5,6,8,8a-octahydro-1H-azulen-1-yl]butanenitrile.
| Compound Name | 4-[(1S,8aS)-7-oxo-2,3,3a,4,5,6,8,8a-octahydro-1H-azulen-1-yl]butanenitrile |
|---|---|
| PubChem CID | 134861082 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 4-[(1S,8aS)-7-oxo-2,3,3a,4,5,6,8,8a-octahydro-1H-azulen-1-yl]butanenitrile |
| SMILES | N#CCCC[C@H]1CCC2CCCC(=O)C[C@H]21 |
| InChI | InChI=1S/C14H21NO/c15-9-2-1-4-11-7-8-12-5-3-6-13(16)10-14(11)12/h11-12,14H,1-8,10H2/t11-,12?,14-/m0/s1 |
| InChIKey | MVPXSWXCUPXLLB-PSIKVXPXSA-N |
| XLogP | 3.47 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|