C13H14O4S — CID 134861228
6-(4-methylphenyl)sulfonyl-5,6-dihydro-2H-oxepin-7-one (PubChem CID 134861228) has the molecular formula C13H14O4S and a molecular weight of 266.32 g/mol. Its IUPAC name is 6-(4-methylphenyl)sulfonyl-5,6-dihydro-2H-oxepin-7-one.
| Compound Name | 6-(4-methylphenyl)sulfonyl-5,6-dihydro-2H-oxepin-7-one |
|---|---|
| PubChem CID | 134861228 |
| Molecular Formula | C13H14O4S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 6-(4-methylphenyl)sulfonyl-5,6-dihydro-2H-oxepin-7-one |
| SMILES | Cc1ccc(S(=O)(=O)C2CC=CCOC2=O)cc1 |
| InChI | InChI=1S/C13H14O4S/c1-10-5-7-11(8-6-10)18(15,16)12-4-2-3-9-17-13(12)14/h2-3,5-8,12H,4,9H2,1H3 |
| InChIKey | OICJRWXEZMHOJQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|