About (5R)-1-(2,4-dichlorophenyl)-5-methoxypyrrolidin-2-one
(5R)-1-(2,4-dichlorophenyl)-5-methoxypyrrolidin-2-one (PubChem CID 134861311) has the molecular formula C11H11Cl2NO2
and a molecular weight of 260.12 g/mol. Its IUPAC name is (5R)-1-(2,4-dichlorophenyl)-5-methoxypyrrolidin-2-one.
Molecular Properties
| Compound Name | (5R)-1-(2,4-dichlorophenyl)-5-methoxypyrrolidin-2-one |
| PubChem CID | 134861311 |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | (5R)-1-(2,4-dichlorophenyl)-5-methoxypyrrolidin-2-one |
| SMILES | CO[C@@H]1CCC(=O)N1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl2NO2/c1-16-11-5-4-10(15)14(11)9-3-2-7(12)6-8(9)13/h2-3,6,11H,4-5H2,1H3/t11-/m1/s1 |
| InChIKey | QDYFFTAOUAHXDL-LLVKDONJSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5R)-1-(2,4-dichlorophenyl)-5-methoxypyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-1-(2,4-dichlorophenyl)-5-methoxypyrrolidin-2-one?
The IUPAC name of (5R)-1-(2,4-dichlorophenyl)-5-methoxypyrrolidin-2-one (CID 134861311) is (5R)-1-(2,4-dichlorophenyl)-5-methoxypyrrolidin-2-one.
What is the SMILES notation for (5R)-1-(2,4-dichlorophenyl)-5-methoxypyrrolidin-2-one?
The canonical SMILES for (5R)-1-(2,4-dichlorophenyl)-5-methoxypyrrolidin-2-one is CO[C@@H]1CCC(=O)N1c1ccc(Cl)cc1Cl.
What is the InChIKey of (5R)-1-(2,4-dichlorophenyl)-5-methoxypyrrolidin-2-one?
The InChIKey is QDYFFTAOUAHXDL-LLVKDONJSA-N. The full InChI is InChI=1S/C11H11Cl2NO2/c1-16-11-5-4-10(15)14(11)9-3-2-7(12)6-8(9)13/h2-3,6,11H,4-5H2,1H3/t11-/m1/s1.
What are the key properties of (5R)-1-(2,4-dichlorophenyl)-5-methoxypyrrolidin-2-one?
(5R)-1-(2,4-dichlorophenyl)-5-methoxypyrrolidin-2-one has a molecular weight of 260.12 g/mol, XLogP of 3.09, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-1-(2,4-dichlorophenyl)-5-methoxypyrrolidin-2-one is sourced from PubChem (CID 134861311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).