About (1S,5S)-3-ethenyl-8-oxabicyclo[3.2.1]octa-2,6-diene
(1S,5S)-3-ethenyl-8-oxabicyclo[3.2.1]octa-2,6-diene (PubChem CID 134861425) has the molecular formula C9H10O
and a molecular weight of 134.18 g/mol. Its IUPAC name is (1S,5S)-3-ethenyl-8-oxabicyclo[3.2.1]octa-2,6-diene.
Molecular Properties
| Compound Name | (1S,5S)-3-ethenyl-8-oxabicyclo[3.2.1]octa-2,6-diene |
| PubChem CID | 134861425 |
| Molecular Formula | C9H10O |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.07 |
| IUPAC Name | (1S,5S)-3-ethenyl-8-oxabicyclo[3.2.1]octa-2,6-diene |
| SMILES | C=CC1=C[C@@H]2C=C[C@H](C1)O2 |
| InChI | InChI=1S/C9H10O/c1-2-7-5-8-3-4-9(6-7)10-8/h2-5,8-9H,1,6H2/t8-,9+/m0/s1 |
| InChIKey | RPTNXGQZJDYXJW-DTWKUNHWSA-N |
| XLogP | 1.83 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,5S)-3-ethenyl-8-oxabicyclo[3.2.1]octa-2,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5S)-3-ethenyl-8-oxabicyclo[3.2.1]octa-2,6-diene?
The IUPAC name of (1S,5S)-3-ethenyl-8-oxabicyclo[3.2.1]octa-2,6-diene (CID 134861425) is (1S,5S)-3-ethenyl-8-oxabicyclo[3.2.1]octa-2,6-diene.
What is the SMILES notation for (1S,5S)-3-ethenyl-8-oxabicyclo[3.2.1]octa-2,6-diene?
The canonical SMILES for (1S,5S)-3-ethenyl-8-oxabicyclo[3.2.1]octa-2,6-diene is C=CC1=C[C@@H]2C=C[C@H](C1)O2.
What is the InChIKey of (1S,5S)-3-ethenyl-8-oxabicyclo[3.2.1]octa-2,6-diene?
The InChIKey is RPTNXGQZJDYXJW-DTWKUNHWSA-N. The full InChI is InChI=1S/C9H10O/c1-2-7-5-8-3-4-9(6-7)10-8/h2-5,8-9H,1,6H2/t8-,9+/m0/s1.
What are the key properties of (1S,5S)-3-ethenyl-8-oxabicyclo[3.2.1]octa-2,6-diene?
(1S,5S)-3-ethenyl-8-oxabicyclo[3.2.1]octa-2,6-diene has a molecular weight of 134.18 g/mol, XLogP of 1.83, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5S)-3-ethenyl-8-oxabicyclo[3.2.1]octa-2,6-diene is sourced from PubChem (CID 134861425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).